C13H16N3O2P — CID 137252842
2-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(2-phosphanylethoxy)phenol (PubChem CID 137252842) has the molecular formula C13H16N3O2P and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(2-phosphanylethoxy)phenol.
| Compound Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(2-phosphanylethoxy)phenol |
|---|---|
| PubChem CID | 137252842 |
| Molecular Formula | C13H16N3O2P |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(2-phosphanylethoxy)phenol |
| SMILES | Cc1nc(C)nc(-c2ccc(OCCP)cc2O)n1 |
| InChI | InChI=1S/C13H16N3O2P/c1-8-14-9(2)16-13(15-8)11-4-3-10(7-12(11)17)18-5-6-19/h3-4,7,17H,5-6,19H2,1-2H3 |
| InChIKey | XIORWLPAGYXFDJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|