C28H22ClN5O3 — CID 137253147
(3R)-8-chloro-4-[[4-[(Z)-N-hydroxy-C-pyridin-2-ylcarbonimidoyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 137253147) has the molecular formula C28H22ClN5O3 and a molecular weight of 511.97 g/mol. Its IUPAC name is (3R)-8-chloro-4-[[4-[(Z)-N-hydroxy-C-pyridin-2-ylcarbonimidoyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3R)-8-chloro-4-[[4-[(Z)-N-hydroxy-C-pyridin-2-ylcarbonimidoyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 137253147 |
| Molecular Formula | C28H22ClN5O3 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | (3R)-8-chloro-4-[[4-[(Z)-N-hydroxy-C-pyridin-2-ylcarbonimidoyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1Nc2cc(Cl)ccc2C(=O)N(Cc2ccc(/C(=N/O)c3ccccn3)cc2)[C@@H]1Cc1ccccn1 |
| InChI | InChI=1S/C28H22ClN5O3/c29-20-11-12-22-24(15-20)32-27(35)25(16-21-5-1-3-13-30-21)34(28(22)36)17-18-7-9-19(10-8-18)26(33-37)23-6-2-4-14-31-23/h1-15,25,37H,16-17H2,(H,32,35)/b33-26-/t25-/m1/s1 |
| InChIKey | REGOXPJRQMCKTG-OOCQWHAFSA-N |
| XLogP | 4.56 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|