C15H24N4O3S — CID 137253326
N-[2-(butylamino)-2-oxoethyl]-N-methyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 137253326) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[2-(butylamino)-2-oxoethyl]-N-methyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | N-[2-(butylamino)-2-oxoethyl]-N-methyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 137253326 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-(butylamino)-2-oxoethyl]-N-methyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCCCNC(=O)CN(C)C(=O)C(C)Sc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H24N4O3S/c1-5-6-7-16-13(21)9-19(4)14(22)11(3)23-15-17-10(2)8-12(20)18-15/h8,11H,5-7,9H2,1-4H3,(H,16,21)(H,17,18,20) |
| InChIKey | MRQUAYHZGONEMA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|