C23H28ClN7O3 — CID 137253759
2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(2-methoxyethoxy)ethyl]-1H-indole-6-carboxamide (PubChem CID 137253759) has the molecular formula C23H28ClN7O3 and a molecular weight of 485.98 g/mol. Its IUPAC name is 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(2-methoxyethoxy)ethyl]-1H-indole-6-carboxamide.
| Compound Name | 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(2-methoxyethoxy)ethyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 137253759 |
| Molecular Formula | C23H28ClN7O3 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(2-methoxyethoxy)ethyl]-1H-indole-6-carboxamide |
| SMILES | COCCOCCNC(=O)c1ccc2c(Cl)c(-c3nn(C(C)(C)C)c4ncnc(N)c34)[nH]c2c1 |
| InChI | InChI=1S/C23H28ClN7O3/c1-23(2,3)31-21-16(20(25)27-12-28-21)18(30-31)19-17(24)14-6-5-13(11-15(14)29-19)22(32)26-7-8-34-10-9-33-4/h5-6,11-12,29H,7-10H2,1-4H3,(H,26,32)(H2,25,27,28) |
| InChIKey | KSCPVLNFZOVQNN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|