C23H29ClN8O — CID 137253767
2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[3-(dimethylamino)propyl]-1H-indole-6-carboxamide (PubChem CID 137253767) has the molecular formula C23H29ClN8O and a molecular weight of 468.99 g/mol. Its IUPAC name is 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[3-(dimethylamino)propyl]-1H-indole-6-carboxamide.
| Compound Name | 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[3-(dimethylamino)propyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 137253767 |
| Molecular Formula | C23H29ClN8O |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[3-(dimethylamino)propyl]-1H-indole-6-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc2c(Cl)c(-c3nn(C(C)(C)C)c4ncnc(N)c34)[nH]c2c1 |
| InChI | InChI=1S/C23H29ClN8O/c1-23(2,3)32-21-16(20(25)27-12-28-21)18(30-32)19-17(24)14-8-7-13(11-15(14)29-19)22(33)26-9-6-10-31(4)5/h7-8,11-12,29H,6,9-10H2,1-5H3,(H,26,33)(H2,25,27,28) |
| InChIKey | GIPYCLYLHPZHLE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|