C21H21ClF3N7O2 — CID 137253856
2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(trifluoromethoxy)ethyl]-1H-indole-6-carboxamide (PubChem CID 137253856) has the molecular formula C21H21ClF3N7O2 and a molecular weight of 495.89 g/mol. Its IUPAC name is 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(trifluoromethoxy)ethyl]-1H-indole-6-carboxamide.
| Compound Name | 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(trifluoromethoxy)ethyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 137253856 |
| Molecular Formula | C21H21ClF3N7O2 |
| Molecular Weight | 495.89 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-chloro-N-[2-(trifluoromethoxy)ethyl]-1H-indole-6-carboxamide |
| SMILES | CC(C)(C)n1nc(-c2[nH]c3cc(C(=O)NCCOC(F)(F)F)ccc3c2Cl)c2c(N)ncnc21 |
| InChI | InChI=1S/C21H21ClF3N7O2/c1-20(2,3)32-18-13(17(26)28-9-29-18)15(31-32)16-14(22)11-5-4-10(8-12(11)30-16)19(33)27-6-7-34-21(23,24)25/h4-5,8-9,30H,6-7H2,1-3H3,(H,27,33)(H2,26,28,29) |
| InChIKey | BGAAKPTZROFBIL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|