About 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione
7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione (PubChem CID 137254786) has the molecular formula C12H9BrN4O2
and a molecular weight of 321.13 g/mol. Its IUPAC name is 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione.
Molecular Properties
| Compound Name | 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione |
| PubChem CID | 137254786 |
| Molecular Formula | C12H9BrN4O2 |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione |
| SMILES | Cc1nc2[nH]c(=O)n(-c3cccc(Br)c3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H9BrN4O2/c1-6-14-10-9(11(18)15-6)17(12(19)16-10)8-4-2-3-7(13)5-8/h2-5H,1H3,(H2,14,15,16,18,19) |
| InChIKey | CERAQUZEGKJXBT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione?
The IUPAC name of 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione (CID 137254786) is 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione.
What is the SMILES notation for 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione?
The canonical SMILES for 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione is Cc1nc2[nH]c(=O)n(-c3cccc(Br)c3)c2c(=O)[nH]1.
What is the InChIKey of 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione?
The InChIKey is CERAQUZEGKJXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN4O2/c1-6-14-10-9(11(18)15-6)17(12(19)16-10)8-4-2-3-7(13)5-8/h2-5H,1H3,(H2,14,15,16,18,19).
What are the key properties of 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione?
7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione has a molecular weight of 321.13 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-bromophenyl)-2-methyl-1,9-dihydropurine-6,8-dione is sourced from PubChem (CID 137254786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).