C31H27F2N7O — CID 137255133
cyclohexyl-[[5-[7-fluoro-3-[4-(2-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137255133) has the molecular formula C31H27F2N7O and a molecular weight of 551.60 g/mol. Its IUPAC name is cyclohexyl-[[5-[7-fluoro-3-[4-(2-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | cyclohexyl-[[5-[7-fluoro-3-[4-(2-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137255133 |
| Molecular Formula | C31H27F2N7O |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | cyclohexyl-[[5-[7-fluoro-3-[4-(2-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2cc(F)c3n[nH]c(-c4nc5c(-c6ccccc6F)nccc5[nH]4)c3c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C31H27F2N7O/c32-23-9-5-4-8-21(23)27-29-25(10-11-35-27)37-30(38-29)28-22-13-18(14-24(33)26(22)39-40-28)19-12-20(16-34-15-19)36-31(41)17-6-2-1-3-7-17/h4-5,8-17,31,36,41H,1-3,6-7H2,(H,37,38)(H,39,40) |
| InChIKey | QTIKOXNZSYGRSP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|