C29H38N4O5 — CID 137255297
4-[2-(3-acetamidopropyl)-3,4,5,6-tetrahydro-1H-isoquinolin-6-yl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2-oxazole-3-carboxamide (PubChem CID 137255297) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-[2-(3-acetamidopropyl)-3,4,5,6-tetrahydro-1H-isoquinolin-6-yl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[2-(3-acetamidopropyl)-3,4,5,6-tetrahydro-1H-isoquinolin-6-yl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 137255297 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 4-[2-(3-acetamidopropyl)-3,4,5,6-tetrahydro-1H-isoquinolin-6-yl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(-c2cc(C(C)C)c(O)cc2O)c1C1C=CC2=C(CCN(CCCNC(C)=O)C2)C1 |
| InChI | InChI=1S/C29H38N4O5/c1-5-30-29(37)27-26(28(38-32-27)23-14-22(17(2)3)24(35)15-25(23)36)20-7-8-21-16-33(12-9-19(21)13-20)11-6-10-31-18(4)34/h7-8,14-15,17,20,35-36H,5-6,9-13,16H2,1-4H3,(H,30,37)(H,31,34) |
| InChIKey | SQNSQJRMADBMBV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|