About (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one
(4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one (PubChem CID 137256238) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one |
| PubChem CID | 137256238 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one |
| SMILES | C=C/C=c1/nc[nH]c(=O)/c1=C/C=C |
| InChI | InChI=1S/C10H10N2O/c1-3-5-8-9(6-4-2)11-7-12-10(8)13/h3-7H,1-2H2,(H,11,12,13)/b8-5+,9-6+ |
| InChIKey | QFPXPNLGAXJLAW-XVYDYJIPSA-N |
| XLogP | -0.30 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one?
The IUPAC name of (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one (CID 137256238) is (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one.
What is the SMILES notation for (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one?
The canonical SMILES for (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one is C=C/C=c1/nc[nH]c(=O)/c1=C/C=C.
What is the InChIKey of (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one?
The InChIKey is QFPXPNLGAXJLAW-XVYDYJIPSA-N. The full InChI is InChI=1S/C10H10N2O/c1-3-5-8-9(6-4-2)11-7-12-10(8)13/h3-7H,1-2H2,(H,11,12,13)/b8-5+,9-6+.
What are the key properties of (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one?
(4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one has a molecular weight of 174.20 g/mol, XLogP of -0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-bis(prop-2-enylidene)-1H-pyrimidin-6-one is sourced from PubChem (CID 137256238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).