C22H28FN3O2 — CID 137256444
2-(3-fluorophenyl)-6-nonanoyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 137256444) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-6-nonanoyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-fluorophenyl)-6-nonanoyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137256444 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-(3-fluorophenyl)-6-nonanoyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCC(=O)N1CCc2nc(-c3cccc(F)c3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C22H28FN3O2/c1-2-3-4-5-6-7-11-20(27)26-13-12-19-18(15-26)22(28)25-21(24-19)16-9-8-10-17(23)14-16/h8-10,14H,2-7,11-13,15H2,1H3,(H,24,25,28) |
| InChIKey | VAPZPMLUSNVQLZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|