C19H23N3O3S — CID 137256782
(1S,10R)-13-(2-ethylphenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 137256782) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (1S,10R)-13-(2-ethylphenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10R)-13-(2-ethylphenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 137256782 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (1S,10R)-13-(2-ethylphenyl)sulfonyl-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | CCc1ccccc1S(=O)(=O)N1[C@@H]2CC[C@H]1Cc1nc(C)[nH]c(=O)c1C2 |
| InChI | InChI=1S/C19H23N3O3S/c1-3-13-6-4-5-7-18(13)26(24,25)22-14-8-9-15(22)11-17-16(10-14)19(23)21-12(2)20-17/h4-7,14-15H,3,8-11H2,1-2H3,(H,20,21,23)/t14-,15+/m1/s1 |
| InChIKey | UKJSIOSCPZSUDK-CABCVRRESA-N |
| XLogP | 1.96 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |