C13H18N6 — CID 137257070
6-(1-ethylpyrazol-4-yl)-2-N,3-N,4-N-trimethyl-1H-pyridine-2,3,4-triimine (PubChem CID 137257070) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 6-(1-ethylpyrazol-4-yl)-2-N,3-N,4-N-trimethyl-1H-pyridine-2,3,4-triimine.
| Compound Name | 6-(1-ethylpyrazol-4-yl)-2-N,3-N,4-N-trimethyl-1H-pyridine-2,3,4-triimine |
|---|---|
| PubChem CID | 137257070 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 6-(1-ethylpyrazol-4-yl)-2-N,3-N,4-N-trimethyl-1H-pyridine-2,3,4-triimine |
| SMILES | CCn1cc(C2=CC(=N\C)/C(=N\C)C(=N\C)/N2)cn1 |
| InChI | InChI=1S/C13H18N6/c1-5-19-8-9(7-17-19)10-6-11(14-2)12(15-3)13(16-4)18-10/h6-8H,5H2,1-4H3,(H,16,18)/b14-11+,15-12+ |
| InChIKey | NMSQJOBNXDKWIM-LCPPQYOVSA-N |
| XLogP | 1.02 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|