C23H36N4 — CID 137257099
(3E,5Z)-N-butyl-7-(5-ethenylimino-7-methylimino-1,2-dihydroazepin-2-yl)-N-ethylocta-3,5,7-trien-4-amine (PubChem CID 137257099) has the molecular formula C23H36N4 and a molecular weight of 368.57 g/mol. Its IUPAC name is (3E,5Z)-N-butyl-7-(5-ethenylimino-7-methylimino-1,2-dihydroazepin-2-yl)-N-ethylocta-3,5,7-trien-4-amine.
| Compound Name | (3E,5Z)-N-butyl-7-(5-ethenylimino-7-methylimino-1,2-dihydroazepin-2-yl)-N-ethylocta-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 137257099 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (3E,5Z)-N-butyl-7-(5-ethenylimino-7-methylimino-1,2-dihydroazepin-2-yl)-N-ethylocta-3,5,7-trien-4-amine |
| SMILES | C=C/N=C1\C=CC(C(=C)/C=C\C(=C/CC)N(CC)CCCC)N/C(=N/C)C1 |
| InChI | InChI=1S/C23H36N4/c1-7-11-17-27(10-4)21(12-8-2)15-13-19(5)22-16-14-20(25-9-3)18-23(24-6)26-22/h9,12-16,22H,3,5,7-8,10-11,17-18H2,1-2,4,6H3,(H,24,26)/b15-13-,21-12+,25-20+ |
| InChIKey | UAGALGXHRJDGEZ-ZJSVIAFPSA-N |
| XLogP | 5.05 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|