C15H20ClN3 — CID 137257105
6-[(2E,5Z)-7-chloroocta-2,5,7-trien-3-yl]-2-N,3-N-dimethyl-1,4-dihydropyridine-2,3-diimine (PubChem CID 137257105) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 6-[(2E,5Z)-7-chloroocta-2,5,7-trien-3-yl]-2-N,3-N-dimethyl-1,4-dihydropyridine-2,3-diimine.
| Compound Name | 6-[(2E,5Z)-7-chloroocta-2,5,7-trien-3-yl]-2-N,3-N-dimethyl-1,4-dihydropyridine-2,3-diimine |
|---|---|
| PubChem CID | 137257105 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6-[(2E,5Z)-7-chloroocta-2,5,7-trien-3-yl]-2-N,3-N-dimethyl-1,4-dihydropyridine-2,3-diimine |
| SMILES | C=C(Cl)/C=C\C/C(=C\C)C1=CCC(=N\C)/C(=N\C)N1 |
| InChI | InChI=1S/C15H20ClN3/c1-5-12(8-6-7-11(2)16)13-9-10-14(17-3)15(18-4)19-13/h5-7,9H,2,8,10H2,1,3-4H3,(H,18,19)/b7-6-,12-5+,17-14+ |
| InChIKey | ALXKMJPUTSNIPT-OGMFWERPSA-N |
| XLogP | 3.61 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|