C24H26N4O3 — CID 137257357
3-methanimidoyl-7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-4-[(3-methylideneoxan-4-yl)amino]-1H-quinolin-2-one (PubChem CID 137257357) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-methanimidoyl-7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-4-[(3-methylideneoxan-4-yl)amino]-1H-quinolin-2-one.
| Compound Name | 3-methanimidoyl-7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-4-[(3-methylideneoxan-4-yl)amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 137257357 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-methanimidoyl-7-(2-methoxy-3,5-dimethyl-4-pyridinyl)-4-[(3-methylideneoxan-4-yl)amino]-1H-quinolin-2-one |
| SMILES | [H]/N=C/c1c(NC2CCOCC2=C)c2ccc(-c3c(C)cnc(OC)c3C)cc2[nH]c1=O |
| InChI | InChI=1S/C24H26N4O3/c1-13-11-26-24(30-4)15(3)21(13)16-5-6-17-20(9-16)28-23(29)18(10-25)22(17)27-19-7-8-31-12-14(19)2/h5-6,9-11,19,25H,2,7-8,12H2,1,3-4H3,(H2,27,28,29)/b25-10+ |
| InChIKey | LQLBDTUOKWWUFB-KIBLKLHPSA-N |
| XLogP | 3.97 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|