C7H11N5OS — CID 137257557
1-cyclopropyl-3-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]thiourea (PubChem CID 137257557) has the molecular formula C7H11N5OS and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 137257557 |
| Molecular Formula | C7H11N5OS |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-cyclopropyl-3-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]thiourea |
| SMILES | O=c1[nH]nc(CNC(=S)NC2CC2)[nH]1 |
| InChI | InChI=1S/C7H11N5OS/c13-6-10-5(11-12-6)3-8-7(14)9-4-1-2-4/h4H,1-3H2,(H2,8,9,14)(H2,10,11,12,13) |
| InChIKey | JWHSKIIUSJGFNG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|