C42H26N8O4 — CID 137258639
4-[3-[9-[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthrolin-2-yl]-6-(4-hydroxyphenyl)-1,2,4-triazin-5-yl]phenol (PubChem CID 137258639) has the molecular formula C42H26N8O4 and a molecular weight of 706.72 g/mol. Its IUPAC name is 4-[3-[9-[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthrolin-2-yl]-6-(4-hydroxyphenyl)-1,2,4-triazin-5-yl]phenol.
| Compound Name | 4-[3-[9-[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthrolin-2-yl]-6-(4-hydroxyphenyl)-1,2,4-triazin-5-yl]phenol |
|---|---|
| PubChem CID | 137258639 |
| Molecular Formula | C42H26N8O4 |
| Molecular Weight | 706.72 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | 4-[3-[9-[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthrolin-2-yl]-6-(4-hydroxyphenyl)-1,2,4-triazin-5-yl]phenol |
| SMILES | Oc1ccc(-c2nnc(-c3ccc4ccc5ccc(-c6nnc(-c7ccc(O)cc7)c(-c7ccc(O)cc7)n6)nc5c4n3)nc2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C42H26N8O4/c51-29-13-3-25(4-14-29)37-39(27-7-17-31(53)18-8-27)47-49-41(45-37)33-21-11-23-1-2-24-12-22-34(44-36(24)35(23)43-33)42-46-38(26-5-15-30(52)16-6-26)40(48-50-42)28-9-19-32(54)20-10-28/h1-22,51-54H |
| InChIKey | YUACIRUONPEXQF-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.72 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|