About N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide
N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide (PubChem CID 137259322) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide.
Molecular Properties
| Compound Name | N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide |
| PubChem CID | 137259322 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide |
| SMILES | CCCC1=CC(=O)NC2=C/C(=N/C(=O)C(CCC)CCC)C=CC12 |
| InChI | InChI=1S/C20H28N2O2/c1-4-7-14(8-5-2)20(24)21-16-10-11-17-15(9-6-3)12-19(23)22-18(17)13-16/h10-14,17H,4-9H2,1-3H3,(H,22,23)/b21-16+ |
| InChIKey | ORNRBEQXYZOUJN-LTGZKZEYSA-N |
| XLogP | 4.10 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide?
The IUPAC name of N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide (CID 137259322) is N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide.
What is the SMILES notation for N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide?
The canonical SMILES for N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide is CCCC1=CC(=O)NC2=C/C(=N/C(=O)C(CCC)CCC)C=CC12.
What is the InChIKey of N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide?
The InChIKey is ORNRBEQXYZOUJN-LTGZKZEYSA-N. The full InChI is InChI=1S/C20H28N2O2/c1-4-7-14(8-5-2)20(24)21-16-10-11-17-15(9-6-3)12-19(23)22-18(17)13-16/h10-14,17H,4-9H2,1-3H3,(H,22,23)/b21-16+.
What are the key properties of N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide?
N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide has a molecular weight of 328.46 g/mol, XLogP of 4.10, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-4-propyl-1,4a-dihydroquinolin-7-ylidene)-2-propylpentanamide is sourced from PubChem (CID 137259322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).