C17H21ClN2O2 — CID 137259410
3-chloro-N-(3-ethyl-4-methyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,2-dimethylpropanamide (PubChem CID 137259410) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-chloro-N-(3-ethyl-4-methyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(3-ethyl-4-methyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137259410 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-chloro-N-(3-ethyl-4-methyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,2-dimethylpropanamide |
| SMILES | CCC1=C(C)C2C=C/C(=N\C(=O)C(C)(C)CCl)C=C2NC1=O |
| InChI | InChI=1S/C17H21ClN2O2/c1-5-12-10(2)13-7-6-11(8-14(13)20-15(12)21)19-16(22)17(3,4)9-18/h6-8,13H,5,9H2,1-4H3,(H,20,21)/b19-11+ |
| InChIKey | MDUJULYADNGWJU-YBFXNURJSA-N |
| XLogP | 3.15 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|