C17H22N2O2 — CID 137259494
N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-3,3-dimethylbutanamide (PubChem CID 137259494) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-3,3-dimethylbutanamide.
| Compound Name | N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 137259494 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-(3,4-dimethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-3,3-dimethylbutanamide |
| SMILES | CC1=C(C)C2C=C/C(=N\C(=O)CC(C)(C)C)C=C2NC1=O |
| InChI | InChI=1S/C17H22N2O2/c1-10-11(2)16(21)19-14-8-12(6-7-13(10)14)18-15(20)9-17(3,4)5/h6-8,13H,9H2,1-5H3,(H,19,21)/b18-12+ |
| InChIKey | DHPYFTGLEJLYEF-LDADJPATSA-N |
| XLogP | 2.93 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|