About N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide
N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide (PubChem CID 137259694) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide.
Molecular Properties
| Compound Name | N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide |
| PubChem CID | 137259694 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide |
| SMILES | CC(=O)/N=C1\C=CC2C(=C1)NC(=O)C=C2C(C)(C)C |
| InChI | InChI=1S/C15H18N2O2/c1-9(18)16-10-5-6-11-12(15(2,3)4)8-14(19)17-13(11)7-10/h5-8,11H,1-4H3,(H,17,19)/b16-10+ |
| InChIKey | KKEYTOIRWPQJOA-MHWRWJLKSA-N |
| XLogP | 2.15 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide?
The IUPAC name of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide (CID 137259694) is N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide.
What is the SMILES notation for N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide?
The canonical SMILES for N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide is CC(=O)/N=C1\C=CC2C(=C1)NC(=O)C=C2C(C)(C)C.
What is the InChIKey of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide?
The InChIKey is KKEYTOIRWPQJOA-MHWRWJLKSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-9(18)16-10-5-6-11-12(15(2,3)4)8-14(19)17-13(11)7-10/h5-8,11H,1-4H3,(H,17,19)/b16-10+.
What are the key properties of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide?
N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide has a molecular weight of 258.32 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)acetamide is sourced from PubChem (CID 137259694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).