About N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide
N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide (PubChem CID 137259756) has the molecular formula C20H18Cl2N2O2
and a molecular weight of 389.28 g/mol. Its IUPAC name is N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide |
| PubChem CID | 137259756 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide |
| SMILES | CC(C)(C)C1=CC(=O)NC2=C/C(=N/C(=O)c3cc(Cl)ccc3Cl)C=CC21 |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-20(2,3)15-10-18(25)24-17-9-12(5-6-13(15)17)23-19(26)14-8-11(21)4-7-16(14)22/h4-10,13H,1-3H3,(H,24,25)/b23-12+ |
| InChIKey | NQOVNFUWHPSXAN-FSJBWODESA-N |
| XLogP | 4.75 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide?
The IUPAC name of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide (CID 137259756) is N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide.
What is the SMILES notation for N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide?
The canonical SMILES for N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide is CC(C)(C)C1=CC(=O)NC2=C/C(=N/C(=O)c3cc(Cl)ccc3Cl)C=CC21.
What is the InChIKey of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide?
The InChIKey is NQOVNFUWHPSXAN-FSJBWODESA-N. The full InChI is InChI=1S/C20H18Cl2N2O2/c1-20(2,3)15-10-18(25)24-17-9-12(5-6-13(15)17)23-19(26)14-8-11(21)4-7-16(14)22/h4-10,13H,1-3H3,(H,24,25)/b23-12+.
What are the key properties of N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide?
N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide has a molecular weight of 389.28 g/mol, XLogP of 4.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2,5-dichlorobenzamide is sourced from PubChem (CID 137259756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).