C18H17N3O3 — CID 137260201
5-cyclopropyl-N-(4-ethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-1,2-oxazole-3-carboxamide (PubChem CID 137260201) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-cyclopropyl-N-(4-ethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-(4-ethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 137260201 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-cyclopropyl-N-(4-ethyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-1,2-oxazole-3-carboxamide |
| SMILES | CCC1=CC(=O)NC2=C/C(=N/C(=O)c3cc(C4CC4)on3)C=CC12 |
| InChI | InChI=1S/C18H17N3O3/c1-2-10-7-17(22)20-14-8-12(5-6-13(10)14)19-18(23)15-9-16(24-21-15)11-3-4-11/h5-9,11,13H,2-4H2,1H3,(H,20,22)/b19-12+ |
| InChIKey | OBHFYCGGZZWEEM-XDHOZWIPSA-N |
| XLogP | 2.67 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|