C22H18N2O4 — CID 137260221
7-methoxy-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)-1-benzofuran-2-carboxamide (PubChem CID 137260221) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 7-methoxy-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137260221 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 7-methoxy-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)/N=C3\C=CC4C(=C3)NC(=O)C3=C4CCC3)oc12 |
| InChI | InChI=1S/C22H18N2O4/c1-27-18-7-2-4-12-10-19(28-20(12)18)22(26)23-13-8-9-15-14-5-3-6-16(14)21(25)24-17(15)11-13/h2,4,7-11,15H,3,5-6H2,1H3,(H,24,25)/b23-13+ |
| InChIKey | KUYCXBLKBSMZKF-YDZHTSKRSA-N |
| XLogP | 3.70 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|