C18H15N3O2 — CID 137260397
N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)pyridine-2-carboxamide (PubChem CID 137260397) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)pyridine-2-carboxamide.
| Compound Name | N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 137260397 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)pyridine-2-carboxamide |
| SMILES | O=C1NC2=C/C(=N/C(=O)c3ccccn3)C=CC2C2=C1CCC2 |
| InChI | InChI=1S/C18H15N3O2/c22-17-14-5-3-4-12(14)13-8-7-11(10-16(13)21-17)20-18(23)15-6-1-2-9-19-15/h1-2,6-10,13H,3-5H2,(H,21,22)/b20-11+ |
| InChIKey | WGRSRWYJBIOTRR-RGVLZGJSSA-N |
| XLogP | 2.34 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|