C16H18N2O3 — CID 137260565
ethyl (NZ)-N-(6-oxo-5,7,8,9,10,10b-hexahydrophenanthridin-3-ylidene)carbamate (PubChem CID 137260565) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl (NZ)-N-(6-oxo-5,7,8,9,10,10b-hexahydrophenanthridin-3-ylidene)carbamate.
| Compound Name | ethyl (NZ)-N-(6-oxo-5,7,8,9,10,10b-hexahydrophenanthridin-3-ylidene)carbamate |
|---|---|
| PubChem CID | 137260565 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | ethyl (NZ)-N-(6-oxo-5,7,8,9,10,10b-hexahydrophenanthridin-3-ylidene)carbamate |
| SMILES | CCOC(=O)/N=C1/C=CC2C(=C1)NC(=O)C1=C2CCCC1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-21-16(20)17-10-7-8-12-11-5-3-4-6-13(11)15(19)18-14(12)9-10/h7-9,12H,2-6H2,1H3,(H,18,19)/b17-10- |
| InChIKey | LZGBGRCSSXTRHG-YVLHZVERSA-N |
| XLogP | 2.65 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|