C13H18F3N5O2 — CID 137260973
1-tert-butyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137260973) has the molecular formula C13H18F3N5O2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 1-tert-butyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-tert-butyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137260973 |
| Molecular Formula | C13H18F3N5O2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-tert-butyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)(C)n1ncc2c(=O)[nH]c(NCCOCC(F)(F)F)nc21 |
| InChI | InChI=1S/C13H18F3N5O2/c1-12(2,3)21-9-8(6-18-21)10(22)20-11(19-9)17-4-5-23-7-13(14,15)16/h6H,4-5,7H2,1-3H3,(H2,17,19,20,22) |
| InChIKey | AOLXBYGIERKIAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|