C23H33N7O — CID 137261058
1-tert-butyl-6-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137261058) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 1-tert-butyl-6-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-tert-butyl-6-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137261058 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-tert-butyl-6-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1cccc(N2CCN(CCCNc3nc4c(cnn4C(C)(C)C)c(=O)[nH]3)CC2)c1 |
| InChI | InChI=1S/C23H33N7O/c1-17-7-5-8-18(15-17)29-13-11-28(12-14-29)10-6-9-24-22-26-20-19(21(31)27-22)16-25-30(20)23(2,3)4/h5,7-8,15-16H,6,9-14H2,1-4H3,(H2,24,26,27,31) |
| InChIKey | RAQVQJQFCZCQEW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|