C11H20N4 — CID 137261963
N,N,6,6-tetramethyl-2-prop-2-enylimino-1,3-dihydropyrimidin-4-amine (PubChem CID 137261963) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N,6,6-tetramethyl-2-prop-2-enylimino-1,3-dihydropyrimidin-4-amine.
| Compound Name | N,N,6,6-tetramethyl-2-prop-2-enylimino-1,3-dihydropyrimidin-4-amine |
|---|---|
| PubChem CID | 137261963 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N,N,6,6-tetramethyl-2-prop-2-enylimino-1,3-dihydropyrimidin-4-amine |
| SMILES | C=CC/N=C1\NC(N(C)C)=CC(C)(C)N1 |
| InChI | InChI=1S/C11H20N4/c1-6-7-12-10-13-9(15(4)5)8-11(2,3)14-10/h6,8H,1,7H2,2-5H3,(H2,12,13,14) |
| InChIKey | MMWZJRTTYOZBRL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|