About 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol
2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol (PubChem CID 137261987) has the molecular formula C19H19ClN4O2
and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol.
Molecular Properties
| Compound Name | 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol |
| PubChem CID | 137261987 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol |
| SMILES | Cc1cccc(O)c1-c1nc(N2CCCOCC2)c2ncc(Cl)cc2n1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-12-4-2-5-15(25)16(12)18-22-14-10-13(20)11-21-17(14)19(23-18)24-6-3-8-26-9-7-24/h2,4-5,10-11,25H,3,6-9H2,1H3 |
| InChIKey | CBGHMNYSCIGOEM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol?
The IUPAC name of 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol (CID 137261987) is 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol.
What is the SMILES notation for 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol?
The canonical SMILES for 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol is Cc1cccc(O)c1-c1nc(N2CCCOCC2)c2ncc(Cl)cc2n1.
What is the InChIKey of 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol?
The InChIKey is CBGHMNYSCIGOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN4O2/c1-12-4-2-5-15(25)16(12)18-22-14-10-13(20)11-21-17(14)19(23-18)24-6-3-8-26-9-7-24/h2,4-5,10-11,25H,3,6-9H2,1H3.
What are the key properties of 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol?
2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol has a molecular weight of 370.84 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-chloro-4-(1,4-oxazepan-4-yl)pyrido[3,2-d]pyrimidin-2-yl]-3-methylphenol is sourced from PubChem (CID 137261987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).