C10H13N3O3 — CID 137263252
4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-1H-pyrimidin-6-one (PubChem CID 137263252) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137263252 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N2CCC3(C2)OCCO3)nc[nH]1 |
| InChI | InChI=1S/C10H13N3O3/c14-9-5-8(11-7-12-9)13-2-1-10(6-13)15-3-4-16-10/h5,7H,1-4,6H2,(H,11,12,14) |
| InChIKey | XDOFTLSJWRQPIP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |