C17H15N3O3 — CID 137264134
2-[1-(1,3-benzodioxol-5-yl)ethylamino]-3H-quinazolin-4-one (PubChem CID 137264134) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-3H-quinazolin-4-one.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137264134 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-3H-quinazolin-4-one |
| SMILES | CC(Nc1nc2ccccc2c(=O)[nH]1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15N3O3/c1-10(11-6-7-14-15(8-11)23-9-22-14)18-17-19-13-5-3-2-4-12(13)16(21)20-17/h2-8,10H,9H2,1H3,(H2,18,19,20,21) |
| InChIKey | LDIWSVMXZYWSLV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |