About 2-ethanehydrazonoyl-3,5-difluorophenol
2-ethanehydrazonoyl-3,5-difluorophenol (PubChem CID 137265692) has the molecular formula C8H8F2N2O
and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-ethanehydrazonoyl-3,5-difluorophenol.
Molecular Properties
| Compound Name | 2-ethanehydrazonoyl-3,5-difluorophenol |
| PubChem CID | 137265692 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-ethanehydrazonoyl-3,5-difluorophenol |
| SMILES | C/C(=N\N)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C8H8F2N2O/c1-4(12-11)8-6(10)2-5(9)3-7(8)13/h2-3,13H,11H2,1H3/b12-4+ |
| InChIKey | DNNRLZHUHWNJEQ-UUILKARUSA-N |
| XLogP | 1.35 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethanehydrazonoyl-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethanehydrazonoyl-3,5-difluorophenol?
The IUPAC name of 2-ethanehydrazonoyl-3,5-difluorophenol (CID 137265692) is 2-ethanehydrazonoyl-3,5-difluorophenol.
What is the SMILES notation for 2-ethanehydrazonoyl-3,5-difluorophenol?
The canonical SMILES for 2-ethanehydrazonoyl-3,5-difluorophenol is C/C(=N\N)c1c(O)cc(F)cc1F.
What is the InChIKey of 2-ethanehydrazonoyl-3,5-difluorophenol?
The InChIKey is DNNRLZHUHWNJEQ-UUILKARUSA-N. The full InChI is InChI=1S/C8H8F2N2O/c1-4(12-11)8-6(10)2-5(9)3-7(8)13/h2-3,13H,11H2,1H3/b12-4+.
What are the key properties of 2-ethanehydrazonoyl-3,5-difluorophenol?
2-ethanehydrazonoyl-3,5-difluorophenol has a molecular weight of 186.16 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethanehydrazonoyl-3,5-difluorophenol is sourced from PubChem (CID 137265692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).