C18H14ClNO4S3 — CID 1372659
(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1372659) has the molecular formula C18H14ClNO4S3 and a molecular weight of 439.97 g/mol. Its IUPAC name is (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1372659 |
| Molecular Formula | C18H14ClNO4S3 |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3cccc(Cl)c3)o2)SC(=S)N1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H14ClNO4S3/c19-12-3-1-2-11(8-12)15-5-4-14(24-15)9-16-17(21)20(18(25)26-16)13-6-7-27(22,23)10-13/h1-5,8-9,13H,6-7,10H2/b16-9-/t13-/m1/s1 |
| InChIKey | RCIMVVVNOLAAOT-WPBJZHHJSA-N |
| XLogP | 3.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|