C17H22N4O2S — CID 137266135
N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137266135) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137266135 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H22N4O2S/c1-11(14-10-21(17(3,4)5)19-12(14)2)18-16-13-8-6-7-9-15(13)24(22,23)20-16/h6-11H,1-5H3,(H,18,20) |
| InChIKey | OGDFTLUSHRYCOF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|