C16H14F3N7OS — CID 137266202
2-[[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-methylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 137266202) has the molecular formula C16H14F3N7OS and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-[[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-methylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-methylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137266202 |
| Molecular Formula | C16H14F3N7OS |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-[[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-methylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1c(N(C)Cc2nc3ccsc3c(=O)[nH]2)nn2c(C(F)(F)F)nnc2c1C |
| InChI | InChI=1S/C16H14F3N7OS/c1-7-8(2)13(24-26-12(7)22-23-15(26)16(17,18)19)25(3)6-10-20-9-4-5-28-11(9)14(27)21-10/h4-5H,6H2,1-3H3,(H,20,21,27) |
| InChIKey | BZMKTGUFJFCAQE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |