About 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one
5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one (PubChem CID 137266504) has the molecular formula C11H10N4O2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one |
| PubChem CID | 137266504 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one |
| SMILES | C=C1N=NC(=O)N/C1=N\c1cc(C)ccc1O |
| InChI | InChI=1S/C11H10N4O2/c1-6-3-4-9(16)8(5-6)12-10-7(2)14-15-11(17)13-10/h3-5,16H,2H2,1H3,(H,12,13,17) |
| InChIKey | VUGIIZRPIPUCFX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one?
The IUPAC name of 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one (CID 137266504) is 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one.
What is the SMILES notation for 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one?
The canonical SMILES for 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one is C=C1N=NC(=O)N/C1=N\c1cc(C)ccc1O.
What is the InChIKey of 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one?
The InChIKey is VUGIIZRPIPUCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2/c1-6-3-4-9(16)8(5-6)12-10-7(2)14-15-11(17)13-10/h3-5,16H,2H2,1H3,(H,12,13,17).
What are the key properties of 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one?
5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one has a molecular weight of 230.23 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxy-5-methylphenyl)imino-6-methylidene-1,2,4-triazin-3-one is sourced from PubChem (CID 137266504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).