About 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol
5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol (PubChem CID 137266657) has the molecular formula C23H26N2O
and a molecular weight of 346.47 g/mol. Its IUPAC name is 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol |
| PubChem CID | 137266657 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol |
| SMILES | Cc1cc(C)c(/N=C/c2ccc3c(C(C)(C)C)ccc(O)c3n2)c(C)c1 |
| InChI | InChI=1S/C23H26N2O/c1-14-11-15(2)21(16(3)12-14)24-13-17-7-8-18-19(23(4,5)6)9-10-20(26)22(18)25-17/h7-13,26H,1-6H3/b24-13+ |
| InChIKey | WEQQDPDRWPCBPF-ZMOGYAJESA-N |
| XLogP | 5.91 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol?
The IUPAC name of 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol (CID 137266657) is 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol.
What is the SMILES notation for 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol?
The canonical SMILES for 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol is Cc1cc(C)c(/N=C/c2ccc3c(C(C)(C)C)ccc(O)c3n2)c(C)c1.
What is the InChIKey of 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol?
The InChIKey is WEQQDPDRWPCBPF-ZMOGYAJESA-N. The full InChI is InChI=1S/C23H26N2O/c1-14-11-15(2)21(16(3)12-14)24-13-17-7-8-18-19(23(4,5)6)9-10-20(26)22(18)25-17/h7-13,26H,1-6H3/b24-13+.
What are the key properties of 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol?
5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol has a molecular weight of 346.47 g/mol, XLogP of 5.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-[(2,4,6-trimethylphenyl)iminomethyl]quinolin-8-ol is sourced from PubChem (CID 137266657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).