C16H16N6O3 — CID 137266794
8-(4-methoxyphenyl)-11,13-dimethyl-2,4,6,7,11,13-hexazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-10,12-dione (PubChem CID 137266794) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-11,13-dimethyl-2,4,6,7,11,13-hexazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-10,12-dione.
| Compound Name | 8-(4-methoxyphenyl)-11,13-dimethyl-2,4,6,7,11,13-hexazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-10,12-dione |
|---|---|
| PubChem CID | 137266794 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 8-(4-methoxyphenyl)-11,13-dimethyl-2,4,6,7,11,13-hexazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-10,12-dione |
| SMILES | COc1ccc(C2c3c(n(C)c(=O)n(C)c3=O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C16H16N6O3/c1-20-13-11(14(23)21(2)16(20)24)12(22-15(19-13)17-8-18-22)9-4-6-10(25-3)7-5-9/h4-8,12H,1-3H3,(H,17,18,19) |
| InChIKey | LORFMGBXHKABDS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |