C21H17ClF3N5O2 — CID 137267583
2-[[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 137267583) has the molecular formula C21H17ClF3N5O2 and a molecular weight of 463.85 g/mol. Its IUPAC name is 2-[[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 137267583 |
| Molecular Formula | C21H17ClF3N5O2 |
| Molecular Weight | 463.85 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C/C(O)=C(/C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H17ClF3N5O2/c1-30(11-19(32)27-12-6-7-15(22)14(8-12)21(23,24)25)10-18(31)13(9-26)20-28-16-4-2-3-5-17(16)29-20/h2-8,31H,10-11H2,1H3,(H,27,32)(H,28,29)/b18-13+ |
| InChIKey | MTQAFKSZTSEDAW-QGOAFFKASA-N |
| XLogP | 4.60 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|