About N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine
N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine (PubChem CID 137267599) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine |
| PubChem CID | 137267599 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine |
| SMILES | C/C(=N\N(C)C)c1c(C)c[nH]c1C |
| InChI | InChI=1S/C10H17N3/c1-7-6-11-8(2)10(7)9(3)12-13(4)5/h6,11H,1-5H3/b12-9+ |
| InChIKey | ORIJWJSZOUCIDY-FMIVXFBMSA-N |
| XLogP | 1.92 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine?
The IUPAC name of N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine (CID 137267599) is N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine.
What is the SMILES notation for N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine?
The canonical SMILES for N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine is C/C(=N\N(C)C)c1c(C)c[nH]c1C.
What is the InChIKey of N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine?
The InChIKey is ORIJWJSZOUCIDY-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H17N3/c1-7-6-11-8(2)10(7)9(3)12-13(4)5/h6,11H,1-5H3/b12-9+.
What are the key properties of N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine?
N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine has a molecular weight of 179.27 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-N-methylmethanamine is sourced from PubChem (CID 137267599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).