About 5-ethylimino-6-methylidene-1,2,4-triazin-3-one
5-ethylimino-6-methylidene-1,2,4-triazin-3-one (PubChem CID 137268634) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 5-ethylimino-6-methylidene-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-ethylimino-6-methylidene-1,2,4-triazin-3-one |
| PubChem CID | 137268634 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5-ethylimino-6-methylidene-1,2,4-triazin-3-one |
| SMILES | C=C1N=NC(=O)N/C1=N\CC |
| InChI | InChI=1S/C6H8N4O/c1-3-7-5-4(2)9-10-6(11)8-5/h2-3H2,1H3,(H,7,8,11) |
| InChIKey | DBGDOGYLOLUINF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylimino-6-methylidene-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylimino-6-methylidene-1,2,4-triazin-3-one?
The IUPAC name of 5-ethylimino-6-methylidene-1,2,4-triazin-3-one (CID 137268634) is 5-ethylimino-6-methylidene-1,2,4-triazin-3-one.
What is the SMILES notation for 5-ethylimino-6-methylidene-1,2,4-triazin-3-one?
The canonical SMILES for 5-ethylimino-6-methylidene-1,2,4-triazin-3-one is C=C1N=NC(=O)N/C1=N\CC.
What is the InChIKey of 5-ethylimino-6-methylidene-1,2,4-triazin-3-one?
The InChIKey is DBGDOGYLOLUINF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c1-3-7-5-4(2)9-10-6(11)8-5/h2-3H2,1H3,(H,7,8,11).
What are the key properties of 5-ethylimino-6-methylidene-1,2,4-triazin-3-one?
5-ethylimino-6-methylidene-1,2,4-triazin-3-one has a molecular weight of 152.16 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylimino-6-methylidene-1,2,4-triazin-3-one is sourced from PubChem (CID 137268634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).