C21H26F2N6O2 — CID 137268829
1-tert-butyl-6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137268829) has the molecular formula C21H26F2N6O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-tert-butyl-6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-tert-butyl-6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137268829 |
| Molecular Formula | C21H26F2N6O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-tert-butyl-6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)(C)n1ncc2c(=O)[nH]c(NC3CCCN(c4ccc(OC(F)F)cc4)C3)nc21 |
| InChI | InChI=1S/C21H26F2N6O2/c1-21(2,3)29-17-16(11-24-29)18(30)27-20(26-17)25-13-5-4-10-28(12-13)14-6-8-15(9-7-14)31-19(22)23/h6-9,11,13,19H,4-5,10,12H2,1-3H3,(H2,25,26,27,30) |
| InChIKey | ZHFHZJIQQWESFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|