About 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one
5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one (PubChem CID 137269308) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one |
| PubChem CID | 137269308 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one |
| SMILES | COc1cc(-c2cnc(=O)[nH]c2)sn1 |
| InChI | InChI=1S/C8H7N3O2S/c1-13-7-2-6(14-11-7)5-3-9-8(12)10-4-5/h2-4H,1H3,(H,9,10,12) |
| InChIKey | CJFQXAFXHGRDAH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one?
The IUPAC name of 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one (CID 137269308) is 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one.
What is the SMILES notation for 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one?
The canonical SMILES for 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one is COc1cc(-c2cnc(=O)[nH]c2)sn1.
What is the InChIKey of 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one?
The InChIKey is CJFQXAFXHGRDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c1-13-7-2-6(14-11-7)5-3-9-8(12)10-4-5/h2-4H,1H3,(H,9,10,12).
What are the key properties of 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one?
5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one has a molecular weight of 209.23 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxy-1,2-thiazol-5-yl)-1H-pyrimidin-2-one is sourced from PubChem (CID 137269308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).