C23H25N5O — CID 137269837
1-tert-butyl-6-(1,2-diphenylethylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137269837) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 1-tert-butyl-6-(1,2-diphenylethylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-tert-butyl-6-(1,2-diphenylethylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137269837 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-tert-butyl-6-(1,2-diphenylethylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)(C)n1ncc2c(=O)[nH]c(NC(Cc3ccccc3)c3ccccc3)nc21 |
| InChI | InChI=1S/C23H25N5O/c1-23(2,3)28-20-18(15-24-28)21(29)27-22(26-20)25-19(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16/h4-13,15,19H,14H2,1-3H3,(H2,25,26,27,29) |
| InChIKey | KCJOTVMACULEDZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |