C25H23N3O5 — CID 137270193
4-[4,6-bis[4-(methoxymethoxy)phenyl]-1,3,5-triazin-2-yl]phenol (PubChem CID 137270193) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-[4,6-bis[4-(methoxymethoxy)phenyl]-1,3,5-triazin-2-yl]phenol.
| Compound Name | 4-[4,6-bis[4-(methoxymethoxy)phenyl]-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 137270193 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 4-[4,6-bis[4-(methoxymethoxy)phenyl]-1,3,5-triazin-2-yl]phenol |
| SMILES | COCOc1ccc(-c2nc(-c3ccc(O)cc3)nc(-c3ccc(OCOC)cc3)n2)cc1 |
| InChI | InChI=1S/C25H23N3O5/c1-30-15-32-21-11-5-18(6-12-21)24-26-23(17-3-9-20(29)10-4-17)27-25(28-24)19-7-13-22(14-8-19)33-16-31-2/h3-14,29H,15-16H2,1-2H3 |
| InChIKey | CSUCUFGUSFDNHI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|