C21H19N3O6 — CID 1372706
N-[2-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]acetamide (PubChem CID 1372706) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[2-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 1372706 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[2-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1C(=O)C(=O)C(=C(O)c2ccccc2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N3O6/c1-13(25)22-10-11-23-18(15-8-5-9-16(12-15)24(29)30)17(20(27)21(23)28)19(26)14-6-3-2-4-7-14/h2-9,12,18,26H,10-11H2,1H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | MNQXNIKPGLZTCO-SFHVURJKSA-N |
| XLogP | 2.15 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|