C20H27N3O3S — CID 137271339
4-cyclohexyl-3-cyclohexylimino-1,1-dioxo-1λ6,2,4-benzothiadiazepin-5-one (PubChem CID 137271339) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-cyclohexyl-3-cyclohexylimino-1,1-dioxo-1λ6,2,4-benzothiadiazepin-5-one.
| Compound Name | 4-cyclohexyl-3-cyclohexylimino-1,1-dioxo-1λ6,2,4-benzothiadiazepin-5-one |
|---|---|
| PubChem CID | 137271339 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-cyclohexyl-3-cyclohexylimino-1,1-dioxo-1λ6,2,4-benzothiadiazepin-5-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C20H27N3O3S/c24-19-17-13-7-8-14-18(17)27(25,26)22-20(21-15-9-3-1-4-10-15)23(19)16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2,(H,21,22) |
| InChIKey | HRIRAPVKOFMXMY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|