C16H14F3N5O — CID 137272373
2-[[ethyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]methyl]-3H-quinazolin-4-one (PubChem CID 137272373) has the molecular formula C16H14F3N5O and a molecular weight of 349.32 g/mol. Its IUPAC name is 2-[[ethyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[ethyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137272373 |
| Molecular Formula | C16H14F3N5O |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[[ethyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]methyl]-3H-quinazolin-4-one |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)c1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C16H14F3N5O/c1-2-24(14-8-7-12(22-23-14)16(17,18)19)9-13-20-11-6-4-3-5-10(11)15(25)21-13/h3-8H,2,9H2,1H3,(H,20,21,25) |
| InChIKey | GMBDXSAUXAKGBF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |